C12H18INO2S — CID 78949637
5-iodo-N-[3-(2-methylpropoxy)propyl]thiophene-3-carboxamide (PubChem CID 78949637) has the molecular formula C12H18INO2S and a molecular weight of 367.25 g/mol. Its IUPAC name is 5-iodo-N-[3-(2-methylpropoxy)propyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[3-(2-methylpropoxy)propyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78949637 |
| Molecular Formula | C12H18INO2S |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 5-iodo-N-[3-(2-methylpropoxy)propyl]thiophene-3-carboxamide |
| SMILES | CC(C)COCCCNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C12H18INO2S/c1-9(2)7-16-5-3-4-14-12(15)10-6-11(13)17-8-10/h6,8-9H,3-5,7H2,1-2H3,(H,14,15) |
| InChIKey | ASFAHAHCLPBCDE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|