C10H13ClINO2S — CID 106244389
N-(3-chloro-4-methoxybutyl)-5-iodothiophene-3-carboxamide (PubChem CID 106244389) has the molecular formula C10H13ClINO2S and a molecular weight of 373.64 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(3-chloro-4-methoxybutyl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 106244389 |
| Molecular Formula | C10H13ClINO2S |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-5-iodothiophene-3-carboxamide |
| SMILES | COCC(Cl)CCNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C10H13ClINO2S/c1-15-5-8(11)2-3-13-10(14)7-4-9(12)16-6-7/h4,6,8H,2-3,5H2,1H3,(H,13,14) |
| InChIKey | QGWYEVKYUWVJGP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|