C11H12INO5S — CID 107820298
(2S)-2-[(5-iodothiophene-3-carbonyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820298) has the molecular formula C11H12INO5S and a molecular weight of 397.19 g/mol. Its IUPAC name is (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820298 |
| Molecular Formula | C11H12INO5S |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)c1csc(I)c1)C(=O)O |
| InChI | InChI=1S/C11H12INO5S/c1-18-9(14)3-2-7(11(16)17)13-10(15)6-4-8(12)19-5-6/h4-5,7H,2-3H2,1H3,(H,13,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | SGOQRVOETSSFSI-ZETCQYMHSA-N |
| XLogP | 1.49 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|