C11H12N2O7S — CID 107820184
(2S)-5-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 107820184) has the molecular formula C11H12N2O7S and a molecular weight of 316.29 g/mol. Its IUPAC name is (2S)-5-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820184 |
| Molecular Formula | C11H12N2O7S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (2S)-5-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)c1csc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C11H12N2O7S/c1-20-9(14)3-2-7(11(16)17)12-10(15)6-4-8(13(18)19)21-5-6/h4-5,7H,2-3H2,1H3,(H,12,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | FLLDHCZNQIZZMI-ZETCQYMHSA-N |
| XLogP | 0.79 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|