C10H12N2O6S — CID 62479844
4-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]butanoic acid (PubChem CID 62479844) has the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]butanoic acid.
| Compound Name | 4-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 62479844 |
| Molecular Formula | C10H12N2O6S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 4-methoxy-2-[(5-nitrothiophene-3-carbonyl)amino]butanoic acid |
| SMILES | COCCC(NC(=O)c1csc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C10H12N2O6S/c1-18-3-2-7(10(14)15)11-9(13)6-4-8(12(16)17)19-5-6/h4-5,7H,2-3H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | RCOHFFAEBMIBTH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|