C8H11N3O5S — CID 102769782
4-methoxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]butanoic acid (PubChem CID 102769782) has the molecular formula C8H11N3O5S and a molecular weight of 261.26 g/mol. Its IUPAC name is 4-methoxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]butanoic acid.
| Compound Name | 4-methoxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 102769782 |
| Molecular Formula | C8H11N3O5S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 4-methoxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]butanoic acid |
| SMILES | COCCC(Nc1ncc([N+](=O)[O-])s1)C(=O)O |
| InChI | InChI=1S/C8H11N3O5S/c1-16-3-2-5(7(12)13)10-8-9-4-6(17-8)11(14)15/h4-5H,2-3H2,1H3,(H,9,10)(H,12,13) |
| InChIKey | IASPXRILFDKSCS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|