C9H9N3O7S — CID 67866045
(2R)-2-[(5-nitro-1,3-thiazole-2-carbonyl)amino]pentanedioic acid (PubChem CID 67866045) has the molecular formula C9H9N3O7S and a molecular weight of 303.25 g/mol. Its IUPAC name is (2R)-2-[(5-nitro-1,3-thiazole-2-carbonyl)amino]pentanedioic acid.
| Compound Name | (2R)-2-[(5-nitro-1,3-thiazole-2-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 67866045 |
| Molecular Formula | C9H9N3O7S |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | (2R)-2-[(5-nitro-1,3-thiazole-2-carbonyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](NC(=O)c1ncc([N+](=O)[O-])s1)C(=O)O |
| InChI | InChI=1S/C9H9N3O7S/c13-6(14)2-1-4(9(16)17)11-7(15)8-10-3-5(20-8)12(18)19/h3-4H,1-2H2,(H,11,15)(H,13,14)(H,16,17)/t4-/m1/s1 |
| InChIKey | KQMSAODRQOIUOH-SCSAIBSYSA-N |
| XLogP | 0.10 |
| TPSA | 159.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|