C11H17N3O4S — CID 102769844
4-ethyl-6-[(5-nitro-1,3-thiazol-2-yl)amino]hexanoic acid (PubChem CID 102769844) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-ethyl-6-[(5-nitro-1,3-thiazol-2-yl)amino]hexanoic acid.
| Compound Name | 4-ethyl-6-[(5-nitro-1,3-thiazol-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 102769844 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-ethyl-6-[(5-nitro-1,3-thiazol-2-yl)amino]hexanoic acid |
| SMILES | CCC(CCNc1ncc([N+](=O)[O-])s1)CCC(=O)O |
| InChI | InChI=1S/C11H17N3O4S/c1-2-8(3-4-10(15)16)5-6-12-11-13-7-9(19-11)14(17)18/h7-8H,2-6H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | RRQXAGBFRLCANY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|