C9H11N3O5S — CID 15741046
6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid (PubChem CID 15741046) has the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. Its IUPAC name is 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid.
| Compound Name | 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 15741046 |
| Molecular Formula | C9H11N3O5S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H11N3O5S/c13-6(3-1-2-4-8(14)15)11-9-10-5-7(18-9)12(16)17/h5H,1-4H2,(H,14,15)(H,10,11,13) |
| InChIKey | PSROFUVHVGVHCV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|