6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid

C9H11N3O5S — CID 15741046

IUPAC6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid
SMILESO=C(O)CCCCC(=O)Nc1ncc([N+](=O)[O-])s1
InChIInChI=1S/C9H11N3O5S/c13-6(3-1-2-4-8(14)15)11-9-10-5-7(18-9)12(16)17/h5H,1-4H2,(H,14,15)(H,10,11,13)
InChIKeyPSROFUVHVGVHCV-UHFFFAOYSA-N
MW273.27 g/mol
LogP1.63
Rot. Bonds7

About 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid

6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid (PubChem CID 15741046) has the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. Its IUPAC name is 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid.

Molecular Properties

Compound Name6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid
PubChem CID15741046
Molecular FormulaC9H11N3O5S
Molecular Weight273.27 g/mol
Exact Mass273.04
IUPAC Name6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid
SMILESO=C(O)CCCCC(=O)Nc1ncc([N+](=O)[O-])s1
InChIInChI=1S/C9H11N3O5S/c13-6(3-1-2-4-8(14)15)11-9-10-5-7(18-9)12(16)17/h5H,1-4H2,(H,14,15)(H,10,11,13)
InChIKeyPSROFUVHVGVHCV-UHFFFAOYSA-N
XLogP1.63
TPSA122.43 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.27
LogP ≤ 51.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid?
The IUPAC name of 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid (CID 15741046) is 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid.
What is the SMILES notation for 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid?
The canonical SMILES for 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid is O=C(O)CCCCC(=O)Nc1ncc([N+](=O)[O-])s1.
What is the InChIKey of 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid?
The InChIKey is PSROFUVHVGVHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O5S/c13-6(3-1-2-4-8(14)15)11-9-10-5-7(18-9)12(16)17/h5H,1-4H2,(H,14,15)(H,10,11,13).
What are the key properties of 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid?
6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid has a molecular weight of 273.27 g/mol, XLogP of 1.63, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-nitro-1,3-thiazol-2-yl)amino]-6-oxohexanoic acid is sourced from PubChem (CID 15741046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).