C14H18N6O3S — CID 162668898
6-(4-cyclopropyltriazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)hexanamide (PubChem CID 162668898) has the molecular formula C14H18N6O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 6-(4-cyclopropyltriazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)hexanamide.
| Compound Name | 6-(4-cyclopropyltriazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 162668898 |
| Molecular Formula | C14H18N6O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 6-(4-cyclopropyltriazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCn1cc(C2CC2)nn1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H18N6O3S/c21-12(16-14-15-8-13(24-14)20(22)23)4-2-1-3-7-19-9-11(17-18-19)10-5-6-10/h8-10H,1-7H2,(H,15,16,21) |
| InChIKey | OHMAOGZRPJDSIJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|