C9H9N5O3S2 — CID 593328
2-(1-methylimidazol-2-yl)sulfanyl-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 593328) has the molecular formula C9H9N5O3S2 and a molecular weight of 299.34 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)sulfanyl-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 593328 |
| Molecular Formula | C9H9N5O3S2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | Cn1ccnc1SCC(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H9N5O3S2/c1-13-3-2-10-9(13)18-5-6(15)12-8-11-4-7(19-8)14(16)17/h2-4H,5H2,1H3,(H,11,12,15) |
| InChIKey | PCXQYQBVDNCXSH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|