C13H8FN5O4S2 — CID 3963884
2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 3963884) has the molecular formula C13H8FN5O4S2 and a molecular weight of 381.37 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3963884 |
| Molecular Formula | C13H8FN5O4S2 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)o1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H8FN5O4S2/c14-8-3-1-7(2-4-8)11-17-18-13(23-11)24-6-9(20)16-12-15-5-10(25-12)19(21)22/h1-5H,6H2,(H,15,16,20) |
| InChIKey | PTWYRMRQJVJUSE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|