C22H16FN5O2S — CID 18227737
2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 18227737) has the molecular formula C22H16FN5O2S and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 18227737 |
| Molecular Formula | C22H16FN5O2S |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)o1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16FN5O2S/c23-16-8-6-15(7-9-16)21-27-28-22(30-21)31-14-20(29)24-17-10-12-19(13-11-17)26-25-18-4-2-1-3-5-18/h1-13H,14H2,(H,24,29)/b26-25+ |
| InChIKey | CQAXQXWMHXCXDW-OCEACIFDSA-N |
| XLogP | 6.02 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|