C17H12N3O4S- — CID 2413834
4-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 2413834) has the molecular formula C17H12N3O4S- and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | 4-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2413834 |
| Molecular Formula | C17H12N3O4S- |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | O=C(CSc1nnc(-c2ccccc2)o1)Nc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N3O4S/c21-14(18-13-8-6-12(7-9-13)16(22)23)10-25-17-20-19-15(24-17)11-4-2-1-3-5-11/h1-9H,10H2,(H,18,21)(H,22,23)/p-1 |
| InChIKey | PFWUUOQNIHKYDQ-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |