C16H8Br5N3O2S — CID 4118714
N-(2,3,4,5,6-pentabromophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 4118714) has the molecular formula C16H8Br5N3O2S and a molecular weight of 705.85 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentabromophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,3,4,5,6-pentabromophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4118714 |
| Molecular Formula | C16H8Br5N3O2S |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 700.63 |
| IUPAC Name | N-(2,3,4,5,6-pentabromophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)o1)Nc1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C16H8Br5N3O2S/c17-9-10(18)12(20)14(13(21)11(9)19)22-8(25)6-27-16-24-23-15(26-16)7-4-2-1-3-5-7/h1-5H,6H2,(H,22,25) |
| InChIKey | FWPOBBRGMFXFDH-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|