C16H10Cl3N3O2S — CID 5125197
2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 5125197) has the molecular formula C16H10Cl3N3O2S and a molecular weight of 414.70 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 5125197 |
| Molecular Formula | C16H10Cl3N3O2S |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)o1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3N3O2S/c17-10-6-12(19)13(7-11(10)18)20-14(23)8-25-16-22-21-15(24-16)9-4-2-1-3-5-9/h1-7H,8H2,(H,20,23) |
| InChIKey | AAUKHJQMXYTTEY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|