C17H12Cl3N3O3S — CID 126345116
2-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 126345116) has the molecular formula C17H12Cl3N3O3S and a molecular weight of 444.73 g/mol. Its IUPAC name is 2-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 126345116 |
| Molecular Formula | C17H12Cl3N3O3S |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | 2-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1nnc(COc2ccccc2)o1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3N3O3S/c18-11-6-13(20)14(7-12(11)19)21-15(24)9-27-17-23-22-16(26-17)8-25-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,21,24) |
| InChIKey | CVAAYYWUHCXRAM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|