C22H15FN4O4S — CID 4291712
2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)phenyl]acetamide (PubChem CID 4291712) has the molecular formula C22H15FN4O4S and a molecular weight of 450.45 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)phenyl]acetamide.
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4291712 |
| Molecular Formula | C22H15FN4O4S |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)phenyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)o1)Nc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H15FN4O4S/c23-17-7-1-16(2-8-17)21-25-26-22(31-21)32-13-20(28)24-18-9-3-14(4-10-18)15-5-11-19(12-6-15)27(29)30/h1-12H,13H2,(H,24,28) |
| InChIKey | FCQHWRYBSVCABF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|