C17H13N5O6S — CID 5038900
N-(2-methyl-4-nitrophenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 5038900) has the molecular formula C17H13N5O6S and a molecular weight of 415.39 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-methyl-4-nitrophenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5038900 |
| Molecular Formula | C17H13N5O6S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C17H13N5O6S/c1-10-8-13(22(26)27)6-7-14(10)18-15(23)9-29-17-20-19-16(28-17)11-2-4-12(5-3-11)21(24)25/h2-8H,9H2,1H3,(H,18,23) |
| InChIKey | SZCFKOXXLFDGKB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|