C18H15BrN4O4S — CID 126175299
N-(2-bromo-4,5-dimethylphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 126175299) has the molecular formula C18H15BrN4O4S and a molecular weight of 463.31 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 126175299 |
| Molecular Formula | C18H15BrN4O4S |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cc(Br)c(NC(=O)CSc2nnc(-c3cccc([N+](=O)[O-])c3)o2)cc1C |
| InChI | InChI=1S/C18H15BrN4O4S/c1-10-6-14(19)15(7-11(10)2)20-16(24)9-28-18-22-21-17(27-18)12-4-3-5-13(8-12)23(25)26/h3-8H,9H2,1-2H3,(H,20,24) |
| InChIKey | OXFOGYWGMLVXSZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|