C18H15ClN4O6S — CID 5105117
N-(5-chloro-2,4-dimethoxyphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 5105117) has the molecular formula C18H15ClN4O6S and a molecular weight of 450.86 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5105117 |
| Molecular Formula | C18H15ClN4O6S |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CSc2nnc(-c3cccc([N+](=O)[O-])c3)o2)cc1Cl |
| InChI | InChI=1S/C18H15ClN4O6S/c1-27-14-8-15(28-2)13(7-12(14)19)20-16(24)9-30-18-22-21-17(29-18)10-4-3-5-11(6-10)23(25)26/h3-8H,9H2,1-2H3,(H,20,24) |
| InChIKey | ALSVTVOFFUXJBZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|