C16H13N5O5S — CID 3887449
N-(2-methoxy-5-nitrophenyl)-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 3887449) has the molecular formula C16H13N5O5S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3887449 |
| Molecular Formula | C16H13N5O5S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CSc1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C16H13N5O5S/c1-25-13-6-5-10(21(23)24)8-12(13)18-14(22)9-27-16-20-19-15(26-16)11-4-2-3-7-17-11/h2-8H,9H2,1H3,(H,18,22) |
| InChIKey | FELIKOSYAZIHNG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 133.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|