C16H10Cl2N4O4S — CID 56731773
N-(2,4-dichlorophenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 56731773) has the molecular formula C16H10Cl2N4O4S and a molecular weight of 425.25 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 56731773 |
| Molecular Formula | C16H10Cl2N4O4S |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl2N4O4S/c17-10-4-5-13(12(18)7-10)19-14(23)8-27-16-21-20-15(26-16)9-2-1-3-11(6-9)22(24)25/h1-7H,8H2,(H,19,23) |
| InChIKey | XCFPRJZXFLKMJK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|