C19H12ClN5O4S2 — CID 4022976
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4022976) has the molecular formula C19H12ClN5O4S2 and a molecular weight of 473.92 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4022976 |
| Molecular Formula | C19H12ClN5O4S2 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H12ClN5O4S2/c20-13-6-4-11(5-7-13)15-9-30-18(21-15)22-16(26)10-31-19-24-23-17(29-19)12-2-1-3-14(8-12)25(27)28/h1-9H,10H2,(H,21,22,26) |
| InChIKey | GJNRBGQPFHQNIF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|