C17H11N5O5S2 — CID 4602162
2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 4602162) has the molecular formula C17H11N5O5S2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4602162 |
| Molecular Formula | C17H11N5O5S2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccco2)o1)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C17H11N5O5S2/c23-14(9-29-17-21-20-15(27-17)13-2-1-7-26-13)19-16-18-12(8-28-16)10-3-5-11(6-4-10)22(24)25/h1-8H,9H2,(H,18,19,23) |
| InChIKey | FRBXHSVHXWCRHO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 137.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|