C19H12N6O6S2 — CID 5009282
2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 5009282) has the molecular formula C19H12N6O6S2 and a molecular weight of 484.48 g/mol. Its IUPAC name is 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 5009282 |
| Molecular Formula | C19H12N6O6S2 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C19H12N6O6S2/c26-16(21-18-20-15(9-32-18)11-4-6-13(7-5-11)24(27)28)10-33-19-23-22-17(31-19)12-2-1-3-14(8-12)25(29)30/h1-9H,10H2,(H,20,21,26) |
| InChIKey | GYWNYGBCZXBYCY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|