C17H11F2N3O3S2 — CID 7737059
2-(3,4-difluorophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 7737059) has the molecular formula C17H11F2N3O3S2 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 7737059 |
| Molecular Formula | C17H11F2N3O3S2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CSc1ccc(F)c(F)c1)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C17H11F2N3O3S2/c18-13-5-4-12(7-14(13)19)26-9-16(23)21-17-20-15(8-27-17)10-2-1-3-11(6-10)22(24)25/h1-8H,9H2,(H,20,21,23) |
| InChIKey | PCSRYVYQUZPQDT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|