C24H20N4O5S3 — CID 21169008
2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 21169008) has the molecular formula C24H20N4O5S3 and a molecular weight of 540.65 g/mol. Its IUPAC name is 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 21169008 |
| Molecular Formula | C24H20N4O5S3 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SCC(=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)cs3)cc2)cc1 |
| InChI | InChI=1S/C24H20N4O5S3/c1-16-5-11-21(12-6-16)36(32,33)27-18-7-9-20(10-8-18)34-15-23(29)26-24-25-22(14-35-24)17-3-2-4-19(13-17)28(30)31/h2-14,27H,15H2,1H3,(H,25,26,29) |
| InChIKey | BNXWLBGPMCBMSD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|