C25H22N4O5S3 — CID 21169815
2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 21169815) has the molecular formula C25H22N4O5S3 and a molecular weight of 554.68 g/mol. Its IUPAC name is 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 21169815 |
| Molecular Formula | C25H22N4O5S3 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SC(C)C(=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)cs3)cc2)cc1 |
| InChI | InChI=1S/C25H22N4O5S3/c1-16-6-12-22(13-7-16)37(33,34)28-19-8-10-21(11-9-19)36-17(2)24(30)27-25-26-23(15-35-25)18-4-3-5-20(14-18)29(31)32/h3-15,17,28H,1-2H3,(H,26,27,30) |
| InChIKey | FZKIPWDRMZCVNH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|