C15H13N5O3S3 — CID 40956577
(2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 40956577) has the molecular formula C15H13N5O3S3 and a molecular weight of 407.50 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 40956577 |
| Molecular Formula | C15H13N5O3S3 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1nnc(S[C@H](C)C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)s1 |
| InChI | InChI=1S/C15H13N5O3S3/c1-8(25-15-19-18-9(2)26-15)13(21)17-14-16-12(7-24-14)10-4-3-5-11(6-10)20(22)23/h3-8H,1-2H3,(H,16,17,21)/t8-/m1/s1 |
| InChIKey | FNPAEPZGZQKIMC-MRVPVSSYSA-N |
| XLogP | 4.00 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|