C26H20N4O6S2 — CID 18895047
2-[[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895047) has the molecular formula C26H20N4O6S2 and a molecular weight of 548.60 g/mol. Its IUPAC name is 2-[[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895047 |
| Molecular Formula | C26H20N4O6S2 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 2-[[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)c2ccccc2C(=O)O)c1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C26H20N4O6S2/c1-15(23(31)29-26-28-22(14-37-26)16-6-4-8-18(12-16)30(35)36)38-19-9-5-7-17(13-19)27-24(32)20-10-2-3-11-21(20)25(33)34/h2-15H,1H3,(H,27,32)(H,33,34)(H,28,29,31) |
| InChIKey | UPLJZBBZPHYJIH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|