C27H24N4O6S2 — CID 18899427
3,4-dimethoxy-N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18899427) has the molecular formula C27H24N4O6S2 and a molecular weight of 564.65 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18899427 |
| Molecular Formula | C27H24N4O6S2 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 3,4-dimethoxy-N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(SC(C)C(=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)cs3)c2)cc1OC |
| InChI | InChI=1S/C27H24N4O6S2/c1-16(25(32)30-27-29-22(15-38-27)17-6-4-8-20(12-17)31(34)35)39-21-9-5-7-19(14-21)28-26(33)18-10-11-23(36-2)24(13-18)37-3/h4-16H,1-3H3,(H,28,33)(H,29,30,32) |
| InChIKey | AIRWBTBDGTVGLJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|