C25H26N4O4S2 — CID 18900651
N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]cyclohexanecarboxamide (PubChem CID 18900651) has the molecular formula C25H26N4O4S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18900651 |
| Molecular Formula | C25H26N4O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]cyclohexanecarboxamide |
| SMILES | CC(Sc1cccc(NC(=O)C2CCCCC2)c1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C25H26N4O4S2/c1-16(35-21-12-6-10-19(14-21)26-24(31)17-7-3-2-4-8-17)23(30)28-25-27-22(15-34-25)18-9-5-11-20(13-18)29(32)33/h5-6,9-17H,2-4,7-8H2,1H3,(H,26,31)(H,27,28,30) |
| InChIKey | RGWPXLGOVGKMEB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|