C30H28N4O4S2 — CID 19712158
N-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide (PubChem CID 19712158) has the molecular formula C30H28N4O4S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is N-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 19712158 |
| Molecular Formula | C30H28N4O4S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | N-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C30H28N4O4S2/c35-28(21-10-5-2-6-11-21)31-23-14-16-25(17-15-23)40-27(20-8-3-1-4-9-20)29(36)33-30-32-26(19-39-30)22-12-7-13-24(18-22)34(37)38/h1,3-4,7-9,12-19,21,27H,2,5-6,10-11H2,(H,31,35)(H,32,33,36) |
| InChIKey | NVGROYXSGGNIPW-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|