C23H18N4O3S2 — CID 18894515
2-(3-aminophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-phenylacetamide (PubChem CID 18894515) has the molecular formula C23H18N4O3S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-phenylacetamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 18894515 |
| Molecular Formula | C23H18N4O3S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-phenylacetamide |
| SMILES | Nc1cccc(SC(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H18N4O3S2/c24-17-9-5-11-19(13-17)32-21(15-6-2-1-3-7-15)22(28)26-23-25-20(14-31-23)16-8-4-10-18(12-16)27(29)30/h1-14,21H,24H2,(H,25,26,28) |
| InChIKey | JHEGUZPGCLXYCD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|