C30H21BrN4O4S2 — CID 18900130
N-[3-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 18900130) has the molecular formula C30H21BrN4O4S2 and a molecular weight of 645.56 g/mol. Its IUPAC name is N-[3-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 18900130 |
| Molecular Formula | C30H21BrN4O4S2 |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 644.02 |
| IUPAC Name | N-[3-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2nc(-c3ccc(Br)cc3)cs2)c2ccccc2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H21BrN4O4S2/c31-22-13-9-19(10-14-22)26-18-40-30(33-26)34-29(37)27(20-5-2-1-3-6-20)41-25-8-4-7-23(17-25)32-28(36)21-11-15-24(16-12-21)35(38)39/h1-18,27H,(H,32,36)(H,33,34,37) |
| InChIKey | QPNGTPMELXJULI-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|