C30H21ClN4O4S2 — CID 18900050
N-[3-[2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 18900050) has the molecular formula C30H21ClN4O4S2 and a molecular weight of 601.11 g/mol. Its IUPAC name is N-[3-[2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18900050 |
| Molecular Formula | C30H21ClN4O4S2 |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | N-[3-[2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2nc(-c3ccccc3Cl)cs2)c2ccccc2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H21ClN4O4S2/c31-25-15-5-4-14-24(25)26-18-40-30(33-26)34-29(37)27(19-8-2-1-3-9-19)41-23-13-7-11-21(17-23)32-28(36)20-10-6-12-22(16-20)35(38)39/h1-18,27H,(H,32,36)(H,33,34,37) |
| InChIKey | IDECEIURYYLOHQ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|