C25H20N4O4S2 — CID 23100500
N-[4-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 23100500) has the molecular formula C25H20N4O4S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[4-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[4-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 23100500 |
| Molecular Formula | C25H20N4O4S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-[4-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)C(Sc2ccc(NC(=O)c3cccc([N+](=O)[O-])c3)cc2)c2ccccc2)n1 |
| InChI | InChI=1S/C25H20N4O4S2/c1-16-15-34-25(26-16)28-24(31)22(17-6-3-2-4-7-17)35-21-12-10-19(11-13-21)27-23(30)18-8-5-9-20(14-18)29(32)33/h2-15,22H,1H3,(H,27,30)(H,26,28,31) |
| InChIKey | BCIGAYYWZZHPRV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|