C28H22N4O6S — CID 18905227
N-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 18905227) has the molecular formula C28H22N4O6S and a molecular weight of 542.57 g/mol. Its IUPAC name is N-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18905227 |
| Molecular Formula | C28H22N4O6S |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | N-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(Sc1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4O6S/c1-18-13-14-23(32(37)38)17-25(18)30-28(34)26(19-7-3-2-4-8-19)39-24-12-6-10-21(16-24)29-27(33)20-9-5-11-22(15-20)31(35)36/h2-17,26H,1H3,(H,29,33)(H,30,34) |
| InChIKey | BEDSYNWVYAQMHW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|