C30H26N4O4S2 — CID 19317380
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)-2-phenylacetamide (PubChem CID 19317380) has the molecular formula C30H26N4O4S2 and a molecular weight of 570.70 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)-2-phenylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 19317380 |
| Molecular Formula | C30H26N4O4S2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2-methyl-5-nitrophenyl)-2-phenylacetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C(=O)Nc3cc([N+](=O)[O-])ccc3C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H26N4O4S2/c1-19-11-16-25(34(37)38)18-27(19)33-29(36)28(22-7-4-3-5-8-22)40-26-10-6-9-24(17-26)32-30(39)31-23-14-12-21(13-15-23)20(2)35/h3-18,28H,1-2H3,(H,33,36)(H2,31,32,39) |
| InChIKey | DKKBRJBDFPFEQG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|