C33H27N3O2S2 — CID 19317365
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide (PubChem CID 19317365) has the molecular formula C33H27N3O2S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide |
|---|---|
| PubChem CID | 19317365 |
| Molecular Formula | C33H27N3O2S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C(=O)Nc3ccc4ccccc4c3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H27N3O2S2/c1-22(37)23-14-17-27(18-15-23)35-33(39)36-28-12-7-13-30(21-28)40-31(25-9-3-2-4-10-25)32(38)34-29-19-16-24-8-5-6-11-26(24)20-29/h2-21,31H,1H3,(H,34,38)(H2,35,36,39) |
| InChIKey | LAKXMPBCPGZWFA-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|