C31H26N4O3S3 — CID 19318270
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylacetamide (PubChem CID 19318270) has the molecular formula C31H26N4O3S3 and a molecular weight of 598.78 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 19318270 |
| Molecular Formula | C31H26N4O3S3 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylacetamide |
| SMILES | COc1ccc2nc(NC(=O)C(Sc3cccc(NC(=S)Nc4ccc(C(C)=O)cc4)c3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C31H26N4O3S3/c1-19(36)20-11-13-22(14-12-20)32-30(39)33-23-9-6-10-25(17-23)40-28(21-7-4-3-5-8-21)29(37)35-31-34-26-16-15-24(38-2)18-27(26)41-31/h3-18,28H,1-2H3,(H2,32,33,39)(H,34,35,37) |
| InChIKey | CIKAJCLBOHZXNA-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|