C31H29N3O4S2 — CID 19317367
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dimethoxyphenyl)-2-phenylacetamide (PubChem CID 19317367) has the molecular formula C31H29N3O4S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dimethoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dimethoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 19317367 |
| Molecular Formula | C31H29N3O4S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,4-dimethoxyphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(NC(=O)C(Sc2cccc(NC(=S)Nc3ccc(C(C)=O)cc3)c2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C31H29N3O4S2/c1-20(35)21-12-14-23(15-13-21)32-31(39)33-24-10-7-11-26(18-24)40-29(22-8-5-4-6-9-22)30(36)34-27-17-16-25(37-2)19-28(27)38-3/h4-19,29H,1-3H3,(H,34,36)(H2,32,33,39) |
| InChIKey | RWMASMIPPQZWTD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|