C29H27N3O3S2 — CID 19316505
N-(3,5-dimethoxyphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19316505) has the molecular formula C29H27N3O3S2 and a molecular weight of 529.69 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316505 |
| Molecular Formula | C29H27N3O3S2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | COc1cc(NC(=O)C(Sc2cccc(NC(=S)Nc3ccccc3)c2)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C29H27N3O3S2/c1-34-24-16-23(17-25(19-24)35-2)30-28(33)27(20-10-5-3-6-11-20)37-26-15-9-14-22(18-26)32-29(36)31-21-12-7-4-8-13-21/h3-19,27H,1-2H3,(H,30,33)(H2,31,32,36) |
| InChIKey | INFYQUZRUVEPRP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|