C27H24N4O2S2 — CID 19318194
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-4-ylacetamide (PubChem CID 19318194) has the molecular formula C27H24N4O2S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-4-ylacetamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 19318194 |
| Molecular Formula | C27H24N4O2S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenyl-N-pyridin-4-ylacetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C(=O)Nc2ccncc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H24N4O2S2/c1-33-24-13-6-5-12-23(24)31-27(34)30-21-10-7-11-22(18-21)35-25(19-8-3-2-4-9-19)26(32)29-20-14-16-28-17-15-20/h2-18,25H,1H3,(H,28,29,32)(H2,30,31,34) |
| InChIKey | QISKBVXOMRMTFO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|