C26H24N4O3S2 — CID 19318196
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide (PubChem CID 19318196) has the molecular formula C26H24N4O3S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 19318196 |
| Molecular Formula | C26H24N4O3S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C(=O)Nc2cc(C)on2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N4O3S2/c1-17-15-23(30-33-17)29-25(31)24(18-9-4-3-5-10-18)35-20-12-8-11-19(16-20)27-26(34)28-21-13-6-7-14-22(21)32-2/h3-16,24H,1-2H3,(H2,27,28,34)(H,29,30,31) |
| InChIKey | KULIBQVTBLTRHE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|