C31H24Cl2N4O2S3 — CID 19316164
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide (PubChem CID 19316164) has the molecular formula C31H24Cl2N4O2S3 and a molecular weight of 651.67 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 19316164 |
| Molecular Formula | C31H24Cl2N4O2S3 |
| Molecular Weight | 651.67 g/mol |
| Exact Mass | 650.04 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-2-phenylacetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)c2ccccc2)c1 |
| InChI | InChI=1S/C31H24Cl2N4O2S3/c1-39-27-13-6-5-12-25(27)35-30(40)34-21-10-7-11-22(17-21)42-28(19-8-3-2-4-9-19)29(38)37-31-36-26(18-41-31)23-15-14-20(32)16-24(23)33/h2-18,28H,1H3,(H2,34,35,40)(H,36,37,38) |
| InChIKey | JUOKMSSGQKOUKH-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.67 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|