C25H20Cl2N4O2S3 — CID 19316128
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide (PubChem CID 19316128) has the molecular formula C25H20Cl2N4O2S3 and a molecular weight of 575.57 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316128 |
| Molecular Formula | C25H20Cl2N4O2S3 |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 574.01 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SCC(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)c1 |
| InChI | InChI=1S/C25H20Cl2N4O2S3/c1-33-22-8-3-2-7-20(22)29-24(34)28-16-5-4-6-17(12-16)35-14-23(32)31-25-30-21(13-36-25)18-10-9-15(26)11-19(18)27/h2-13H,14H2,1H3,(H2,28,29,34)(H,30,31,32) |
| InChIKey | YMBBWFMZCKZMAI-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|