C26H24N4O2S3 — CID 19316141
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 19316141) has the molecular formula C26H24N4O2S3 and a molecular weight of 520.71 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19316141 |
| Molecular Formula | C26H24N4O2S3 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(5-methyl-4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SCC(=O)Nc2nc(-c3ccccc3)c(C)s2)c1 |
| InChI | InChI=1S/C26H24N4O2S3/c1-17-24(18-9-4-3-5-10-18)30-26(35-17)29-23(31)16-34-20-12-8-11-19(15-20)27-25(33)28-21-13-6-7-14-22(21)32-2/h3-15H,16H2,1-2H3,(H2,27,28,33)(H,29,30,31) |
| InChIKey | IQANIILJCFXVDD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|