C23H22ClN3O2S2 — CID 19316911
N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide (PubChem CID 19316911) has the molecular formula C23H22ClN3O2S2 and a molecular weight of 472.04 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316911 |
| Molecular Formula | C23H22ClN3O2S2 |
| Molecular Weight | 472.04 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SCC(=O)Nc2cc(Cl)ccc2C)c1 |
| InChI | InChI=1S/C23H22ClN3O2S2/c1-15-10-11-16(24)12-20(15)26-22(28)14-31-18-7-5-6-17(13-18)25-23(30)27-19-8-3-4-9-21(19)29-2/h3-13H,14H2,1-2H3,(H,26,28)(H2,25,27,30) |
| InChIKey | TXIADIHKYXMNFP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.04 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|